C24H15NO4 — CID 1236177
(4S)-3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione (PubChem CID 1236177) has the molecular formula C24H15NO4 and a molecular weight of 381.39 g/mol. Its IUPAC name is (4S)-3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione.
| Compound Name | (4S)-3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 1236177 |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (4S)-3-benzoyl-4-phenylspiro[4H-1,2-oxazole-5,2'-indene]-1',3'-dione |
| SMILES | O=C(C1=NOC2(C(=O)c3ccccc3C2=O)[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H15NO4/c26-21(16-11-5-2-6-12-16)20-19(15-9-3-1-4-10-15)24(29-25-20)22(27)17-13-7-8-14-18(17)23(24)28/h1-14,19H/t19-/m0/s1 |
| InChIKey | OIEOCNGMVWZUDX-IBGZPJMESA-N |
| XLogP | 3.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|