C9H18N4O5Si2 — CID 123619100
[(2-dimethanimidoyloxysilyl-1-ethenoxypropan-2-yl)-methanimidoyloxysilyl] methanimidate (PubChem CID 123619100) has the molecular formula C9H18N4O5Si2 and a molecular weight of 318.44 g/mol. Its IUPAC name is [(2-dimethanimidoyloxysilyl-1-ethenoxypropan-2-yl)-methanimidoyloxysilyl] methanimidate.
| Compound Name | [(2-dimethanimidoyloxysilyl-1-ethenoxypropan-2-yl)-methanimidoyloxysilyl] methanimidate |
|---|---|
| PubChem CID | 123619100 |
| Molecular Formula | C9H18N4O5Si2 |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [(2-dimethanimidoyloxysilyl-1-ethenoxypropan-2-yl)-methanimidoyloxysilyl] methanimidate |
| SMILES | [H]/N=C\O[SiH](O/C=N/[H])C(C)(COC=C)[SiH](O/C=N/[H])O/C=N/[H] |
| InChI | InChI=1S/C9H18N4O5Si2/c1-3-14-4-9(2,19(15-5-10)16-6-11)20(17-7-12)18-8-13/h3,5-8,10-13,19-20H,1,4H2,2H3/b10-5-,11-6+,12-7+,13-8+ |
| InChIKey | BSEPGULFRIGWHO-JEEJREOFSA-N |
| XLogP | 0.38 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|