About [ethenyl(oxido)amino] methanimidate
[ethenyl(oxido)amino] methanimidate (PubChem CID 163842739) has the molecular formula C3H5N2O2-
and a molecular weight of 101.08 g/mol. Its IUPAC name is [ethenyl(oxido)amino] methanimidate.
Molecular Properties
| Compound Name | [ethenyl(oxido)amino] methanimidate |
| PubChem CID | 163842739 |
| Molecular Formula | C3H5N2O2- |
| Molecular Weight | 101.08 g/mol |
| Exact Mass | 101.04 |
| IUPAC Name | [ethenyl(oxido)amino] methanimidate |
| SMILES | [H]/N=C/ON([O-])C=C |
| InChI | InChI=1S/C3H5N2O2/c1-2-5(6)7-3-4/h2-4H,1H2/q-1/b4-3+ |
| InChIKey | WPNJFTNHZWZVJQ-ONEGZZNKSA-N |
| XLogP | 0.47 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.08 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [ethenyl(oxido)amino] methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethenyl(oxido)amino] methanimidate?
The IUPAC name of [ethenyl(oxido)amino] methanimidate (CID 163842739) is [ethenyl(oxido)amino] methanimidate.
What is the SMILES notation for [ethenyl(oxido)amino] methanimidate?
The canonical SMILES for [ethenyl(oxido)amino] methanimidate is [H]/N=C/ON([O-])C=C.
What is the InChIKey of [ethenyl(oxido)amino] methanimidate?
The InChIKey is WPNJFTNHZWZVJQ-ONEGZZNKSA-N. The full InChI is InChI=1S/C3H5N2O2/c1-2-5(6)7-3-4/h2-4H,1H2/q-1/b4-3+.
What are the key properties of [ethenyl(oxido)amino] methanimidate?
[ethenyl(oxido)amino] methanimidate has a molecular weight of 101.08 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [ethenyl(oxido)amino] methanimidate is sourced from PubChem (CID 163842739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).