About CID 123630078
CID 123630078 (PubChem CID 123630078) has the molecular formula C34H53B5N8O8
and a molecular weight of 755.91 g/mol.
Molecular Properties
| Compound Name | CID 123630078 |
| PubChem CID | 123630078 |
| Molecular Formula | C34H53B5N8O8 |
| Molecular Weight | 755.91 g/mol |
| Exact Mass | 756.45 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCN2CCN(CCCOc3ccc(C(=O)OC)cc3)CCN(B(C)O)CCN(CCN(C([B])=O)CC1)CCN(C([B])=O)CCN(C([B])=O)CC2 |
| InChI | InChI=1S/C34H53B5N8O8/c1-39(53)47-25-15-40(8-3-27-55-29-6-4-28(5-7-29)30(48)54-2)9-10-41-11-17-43(31(35)49)21-23-45(33(37)51)19-13-42(16-26-47)14-20-46(34(38)52)24-22-44(18-12-41)32(36)50/h4-7,53H,3,8-27H2,1-2H3 |
| InChIKey | XAMMNNHEJTUIGR-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 755.91 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123630078 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123630078?
The IUPAC name of CID 123630078 (CID 123630078) is not available.
What is the SMILES notation for CID 123630078?
The canonical SMILES for CID 123630078 is [B]C(=O)N1CCN2CCN(CCCOc3ccc(C(=O)OC)cc3)CCN(B(C)O)CCN(CCN(C([B])=O)CC1)CCN(C([B])=O)CCN(C([B])=O)CC2.
What is the InChIKey of CID 123630078?
The InChIKey is XAMMNNHEJTUIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H53B5N8O8/c1-39(53)47-25-15-40(8-3-27-55-29-6-4-28(5-7-29)30(48)54-2)9-10-41-11-17-43(31(35)49)21-23-45(33(37)51)19-13-42(16-26-47)14-20-46(34(38)52)24-22-44(18-12-41)32(36)50/h4-7,53H,3,8-27H2,1-2H3.
What are the key properties of CID 123630078?
CID 123630078 has a molecular weight of 755.91 g/mol, XLogP of -1.05, 7 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123630078 is sourced from PubChem (CID 123630078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).