About CID 123952958
CID 123952958 (PubChem CID 123952958) has the molecular formula C33H51B5N8O8
and a molecular weight of 741.88 g/mol.
Molecular Properties
| Compound Name | CID 123952958 |
| PubChem CID | 123952958 |
| Molecular Formula | C33H51B5N8O8 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 742.43 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCN2CCN(CCCOc3ccc(C(=O)O)cc3)CCN(B(C)O)CCN(CCN(C([B])=O)CC1)CCN(C([B])=O)CCN(C([B])=O)CC2 |
| InChI | InChI=1S/C33H51B5N8O8/c1-38(53)46-24-14-39(7-2-26-54-28-5-3-27(4-6-28)29(47)48)8-9-40-10-16-42(30(34)49)20-22-44(32(36)51)18-12-41(15-25-46)13-19-45(33(37)52)23-21-43(17-11-40)31(35)50/h3-6,53H,2,7-26H2,1H3,(H,47,48) |
| InChIKey | JKSBNQQQJNZRMR-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123952958 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123952958?
The IUPAC name of CID 123952958 (CID 123952958) is not available.
What is the SMILES notation for CID 123952958?
The canonical SMILES for CID 123952958 is [B]C(=O)N1CCN2CCN(CCCOc3ccc(C(=O)O)cc3)CCN(B(C)O)CCN(CCN(C([B])=O)CC1)CCN(C([B])=O)CCN(C([B])=O)CC2.
What is the InChIKey of CID 123952958?
The InChIKey is JKSBNQQQJNZRMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H51B5N8O8/c1-38(53)46-24-14-39(7-2-26-54-28-5-3-27(4-6-28)29(47)48)8-9-40-10-16-42(30(34)49)20-22-44(32(36)51)18-12-41(15-25-46)13-19-45(33(37)52)23-21-43(17-11-40)31(35)50/h3-6,53H,2,7-26H2,1H3,(H,47,48).
What are the key properties of CID 123952958?
CID 123952958 has a molecular weight of 741.88 g/mol, XLogP of -1.14, 7 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123952958 is sourced from PubChem (CID 123952958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).