C33H51B5N8O8 — CID 123952958
CID 123952958 (PubChem CID 123952958) has the molecular formula C33H51B5N8O8 and a molecular weight of 741.88 g/mol.
| Compound Name | CID 123952958 |
|---|---|
| PubChem CID | 123952958 |
| Molecular Formula | C33H51B5N8O8 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 742.43 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCN2CCN(CCCOc3ccc(C(=O)O)cc3)CCN(B(C)O)CCN(CCN(C([B])=O)CC1)CCN(C([B])=O)CCN(C([B])=O)CC2 |
| InChI | InChI=1S/C33H51B5N8O8/c1-38(53)46-24-14-39(7-2-26-54-28-5-3-27(4-6-28)29(47)48)8-9-40-10-16-42(30(34)49)20-22-44(32(36)51)18-12-41(15-25-46)13-19-45(33(37)52)23-21-43(17-11-40)31(35)50/h3-6,53H,2,7-26H2,1H3,(H,47,48) |
| InChIKey | JKSBNQQQJNZRMR-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|