C15H26OP2 — CID 123632113
phosphoroso(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphane (PubChem CID 123632113) has the molecular formula C15H26OP2 and a molecular weight of 284.32 g/mol. Its IUPAC name is phosphoroso(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphane.
| Compound Name | phosphoroso(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphane |
|---|---|
| PubChem CID | 123632113 |
| Molecular Formula | C15H26OP2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | phosphoroso(3,7,11-trimethyldodeca-2,6,10-trienyl)phosphane |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCPP=O |
| InChI | InChI=1S/C15H26OP2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-17-18-16/h7,9,11,17H,5-6,8,10,12H2,1-4H3 |
| InChIKey | SEFYAEUJGZHPPN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|