C15H30 — CID 123632457
2-hexan-3-yl-1,3,4-trimethylcyclohexane (PubChem CID 123632457) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 2-hexan-3-yl-1,3,4-trimethylcyclohexane.
| Compound Name | 2-hexan-3-yl-1,3,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 123632457 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 2-hexan-3-yl-1,3,4-trimethylcyclohexane |
| SMILES | CCCC(CC)C1C(C)CCC(C)C1C |
| InChI | InChI=1S/C15H30/c1-6-8-14(7-2)15-12(4)10-9-11(3)13(15)5/h11-15H,6-10H2,1-5H3 |
| InChIKey | KPCFYVSGVHKOCD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |