About 2-hexan-3-yl-1,3,4-trimethylcyclohexane
2-hexan-3-yl-1,3,4-trimethylcyclohexane (PubChem CID 123632457) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 2-hexan-3-yl-1,3,4-trimethylcyclohexane.
Molecular Properties
| Compound Name | 2-hexan-3-yl-1,3,4-trimethylcyclohexane |
| PubChem CID | 123632457 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 2-hexan-3-yl-1,3,4-trimethylcyclohexane |
| SMILES | CCCC(CC)C1C(C)CCC(C)C1C |
| InChI | InChI=1S/C15H30/c1-6-8-14(7-2)15-12(4)10-9-11(3)13(15)5/h11-15H,6-10H2,1-5H3 |
| InChIKey | KPCFYVSGVHKOCD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-hexan-3-yl-1,3,4-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexan-3-yl-1,3,4-trimethylcyclohexane?
The IUPAC name of 2-hexan-3-yl-1,3,4-trimethylcyclohexane (CID 123632457) is 2-hexan-3-yl-1,3,4-trimethylcyclohexane.
What is the SMILES notation for 2-hexan-3-yl-1,3,4-trimethylcyclohexane?
The canonical SMILES for 2-hexan-3-yl-1,3,4-trimethylcyclohexane is CCCC(CC)C1C(C)CCC(C)C1C.
What is the InChIKey of 2-hexan-3-yl-1,3,4-trimethylcyclohexane?
The InChIKey is KPCFYVSGVHKOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-6-8-14(7-2)15-12(4)10-9-11(3)13(15)5/h11-15H,6-10H2,1-5H3.
What are the key properties of 2-hexan-3-yl-1,3,4-trimethylcyclohexane?
2-hexan-3-yl-1,3,4-trimethylcyclohexane has a molecular weight of 210.40 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexan-3-yl-1,3,4-trimethylcyclohexane is sourced from PubChem (CID 123632457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).