About 3-hexan-3-yltricyclo[4.1.0.02,4]heptane
3-hexan-3-yltricyclo[4.1.0.02,4]heptane (PubChem CID 163727409) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 3-hexan-3-yltricyclo[4.1.0.02,4]heptane.
Molecular Properties
| Compound Name | 3-hexan-3-yltricyclo[4.1.0.02,4]heptane |
| PubChem CID | 163727409 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 3-hexan-3-yltricyclo[4.1.0.02,4]heptane |
| SMILES | CCCC(CC)C1C2CC3CC3C21 |
| InChI | InChI=1S/C13H22/c1-3-5-8(4-2)12-11-7-9-6-10(9)13(11)12/h8-13H,3-7H2,1-2H3 |
| InChIKey | KWTSZVWZVBRIEF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-hexan-3-yltricyclo[4.1.0.02,4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexan-3-yltricyclo[4.1.0.02,4]heptane?
The IUPAC name of 3-hexan-3-yltricyclo[4.1.0.02,4]heptane (CID 163727409) is 3-hexan-3-yltricyclo[4.1.0.02,4]heptane.
What is the SMILES notation for 3-hexan-3-yltricyclo[4.1.0.02,4]heptane?
The canonical SMILES for 3-hexan-3-yltricyclo[4.1.0.02,4]heptane is CCCC(CC)C1C2CC3CC3C21.
What is the InChIKey of 3-hexan-3-yltricyclo[4.1.0.02,4]heptane?
The InChIKey is KWTSZVWZVBRIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-3-5-8(4-2)12-11-7-9-6-10(9)13(11)12/h8-13H,3-7H2,1-2H3.
What are the key properties of 3-hexan-3-yltricyclo[4.1.0.02,4]heptane?
3-hexan-3-yltricyclo[4.1.0.02,4]heptane has a molecular weight of 178.32 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexan-3-yltricyclo[4.1.0.02,4]heptane is sourced from PubChem (CID 163727409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).