C14H29N — CID 167309553
4-hexan-3-yl-1,3,5-trimethylpiperidine (PubChem CID 167309553) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 4-hexan-3-yl-1,3,5-trimethylpiperidine.
| Compound Name | 4-hexan-3-yl-1,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 167309553 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 4-hexan-3-yl-1,3,5-trimethylpiperidine |
| SMILES | CCCC(CC)C1C(C)CN(C)CC1C |
| InChI | InChI=1S/C14H29N/c1-6-8-13(7-2)14-11(3)9-15(5)10-12(14)4/h11-14H,6-10H2,1-5H3 |
| InChIKey | XFOADJDQPCLWAQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |