C10H20FN — CID 156794238
3-fluoro-1,5-dimethyl-4-propan-2-ylpiperidine (PubChem CID 156794238) has the molecular formula C10H20FN and a molecular weight of 173.27 g/mol. Its IUPAC name is 3-fluoro-1,5-dimethyl-4-propan-2-ylpiperidine.
| Compound Name | 3-fluoro-1,5-dimethyl-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 156794238 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | 3-fluoro-1,5-dimethyl-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1C(C)CN(C)CC1F |
| InChI | InChI=1S/C10H20FN/c1-7(2)10-8(3)5-12(4)6-9(10)11/h7-10H,5-6H2,1-4H3 |
| InChIKey | OEPUJQPLRVFBLW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |