C25H27N5O3S — CID 123635876
N-[3-[4-(dimethylamino)but-2-enoylamino]phenyl]-3-methyl-5-oxo-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide (PubChem CID 123635876) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[3-[4-(dimethylamino)but-2-enoylamino]phenyl]-3-methyl-5-oxo-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide.
| Compound Name | N-[3-[4-(dimethylamino)but-2-enoylamino]phenyl]-3-methyl-5-oxo-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 123635876 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[3-[4-(dimethylamino)but-2-enoylamino]phenyl]-3-methyl-5-oxo-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide |
| SMILES | CC1CNc2c(sc3ccc(C(=O)Nc4cccc(NC(=O)C=CCN(C)C)c4)cc23)C(=O)N1 |
| InChI | InChI=1S/C25H27N5O3S/c1-15-14-26-22-19-12-16(9-10-20(19)34-23(22)25(33)27-15)24(32)29-18-7-4-6-17(13-18)28-21(31)8-5-11-30(2)3/h4-10,12-13,15,26H,11,14H2,1-3H3,(H,27,33)(H,28,31)(H,29,32) |
| InChIKey | GQUSOHCDZHNTBD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|