C27H33FN+ — CID 123637047
4-butyl-10,10-diethyl-12-fluoro-13-methyl-8,9-dihydroisoquinolino[1,2-a][2]benzazepin-7-ium (PubChem CID 123637047) has the molecular formula C27H33FN+ and a molecular weight of 390.57 g/mol. Its IUPAC name is 4-butyl-10,10-diethyl-12-fluoro-13-methyl-8,9-dihydroisoquinolino[1,2-a][2]benzazepin-7-ium.
| Compound Name | 4-butyl-10,10-diethyl-12-fluoro-13-methyl-8,9-dihydroisoquinolino[1,2-a][2]benzazepin-7-ium |
|---|---|
| PubChem CID | 123637047 |
| Molecular Formula | C27H33FN+ |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 4-butyl-10,10-diethyl-12-fluoro-13-methyl-8,9-dihydroisoquinolino[1,2-a][2]benzazepin-7-ium |
| SMILES | CCCCc1cccc2c3[n+](ccc12)CCC(CC)(CC)c1cc(F)c(C)cc1-3 |
| InChI | InChI=1S/C27H33FN/c1-5-8-10-20-11-9-12-22-21(20)13-15-29-16-14-27(6-2,7-3)24-18-25(28)19(4)17-23(24)26(22)29/h9,11-13,15,17-18H,5-8,10,14,16H2,1-4H3/q+1 |
| InChIKey | QPFQFCHFWYKBLZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|