C27H41N3O3 — CID 123638009
2-[4-[3-(2,4-diamino-5-hexoxyphenyl)but-2-enyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol (PubChem CID 123638009) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is 2-[4-[3-(2,4-diamino-5-hexoxyphenyl)but-2-enyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol.
| Compound Name | 2-[4-[3-(2,4-diamino-5-hexoxyphenyl)but-2-enyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 123638009 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 2-[4-[3-(2,4-diamino-5-hexoxyphenyl)but-2-enyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
| SMILES | CCCCCCOc1cc(C(C)=CCc2ccc(N(CCO)CCO)cc2C)c(N)cc1N |
| InChI | InChI=1S/C27H41N3O3/c1-4-5-6-7-16-33-27-18-24(25(28)19-26(27)29)20(2)8-9-22-10-11-23(17-21(22)3)30(12-14-31)13-15-32/h8,10-11,17-19,31-32H,4-7,9,12-16,28-29H2,1-3H3 |
| InChIKey | QCVKMFSPTXGKAM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|