C23H34N4O3 — CID 123974124
2-[4-[(3-hexoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]-N-(2-hydroxyethyl)-3-methylanilino]ethanol (PubChem CID 123974124) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[4-[(3-hexoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]-N-(2-hydroxyethyl)-3-methylanilino]ethanol.
| Compound Name | 2-[4-[(3-hexoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 123974124 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-[4-[(3-hexoxy-4,6-diiminocyclohex-2-en-1-ylidene)amino]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
| SMILES | [H]/N=C1\CC(=N\[H])/C(=N/c2ccc(N(CCO)CCO)cc2C)C=C1OCCCCCC |
| InChI | InChI=1S/C23H34N4O3/c1-3-4-5-6-13-30-23-16-22(19(24)15-20(23)25)26-21-8-7-18(14-17(21)2)27(9-11-28)10-12-29/h7-8,14,16,24-25,28-29H,3-6,9-13,15H2,1-2H3/b24-19+,25-20+,26-22+ |
| InChIKey | TYIDUTQKSXMOMV-BBWORMKUSA-N |
| XLogP | 3.78 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|