C13H7F3O3S — CID 123641068
2-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzoic acid (PubChem CID 123641068) has the molecular formula C13H7F3O3S and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzoic acid.
| Compound Name | 2-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123641068 |
| Molecular Formula | C13H7F3O3S |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(C(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C13H7F3O3S/c14-13(15,16)11(17)10-6-5-9(20-10)7-3-1-2-4-8(7)12(18)19/h1-6H,(H,18,19) |
| InChIKey | KUPYHOZGFBJIRK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |