C24H19FN6S — CID 123642202
N'-benzyl-9-(2-fluoro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide (PubChem CID 123642202) has the molecular formula C24H19FN6S and a molecular weight of 442.52 g/mol. Its IUPAC name is N'-benzyl-9-(2-fluoro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide.
| Compound Name | N'-benzyl-9-(2-fluoro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
|---|---|
| PubChem CID | 123642202 |
| Molecular Formula | C24H19FN6S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N'-benzyl-9-(2-fluoro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
| SMILES | Cc1ccc(Nc2ncnc3ccc4nc(/C(N)=N/Cc5ccccc5)sc4c23)c(F)c1 |
| InChI | InChI=1S/C24H19FN6S/c1-14-7-8-17(16(25)11-14)30-23-20-18(28-13-29-23)9-10-19-21(20)32-24(31-19)22(26)27-12-15-5-3-2-4-6-15/h2-11,13H,12H2,1H3,(H2,26,27)(H,28,29,30) |
| InChIKey | NRYCORCQCJWKGC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|