C18H15N5O3S — CID 118352762
9-(2,4-dimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboxamide (PubChem CID 118352762) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is 9-(2,4-dimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboxamide.
| Compound Name | 9-(2,4-dimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 118352762 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 9-(2,4-dimethoxyanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboxamide |
| SMILES | COc1ccc(Nc2ncnc3ccc4nc(C(N)=O)sc4c23)c(OC)c1 |
| InChI | InChI=1S/C18H15N5O3S/c1-25-9-3-4-10(13(7-9)26-2)22-17-14-11(20-8-21-17)5-6-12-15(14)27-18(23-12)16(19)24/h3-8H,1-2H3,(H2,19,24)(H,20,21,22) |
| InChIKey | XAWUXHMSVJHORF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |