C19H18N6OS — CID 71529614
methyl 9-[4-(dimethylamino)anilino]-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 71529614) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is methyl 9-[4-(dimethylamino)anilino]-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | methyl 9-[4-(dimethylamino)anilino]-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 71529614 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 9-[4-(dimethylamino)anilino]-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1nc2ccc3ncnc(Nc4ccc(N(C)C)cc4)c3c2s1 |
| InChI | InChI=1S/C19H18N6OS/c1-25(2)12-6-4-11(5-7-12)23-18-15-13(21-10-22-18)8-9-14-16(15)27-19(24-14)17(20)26-3/h4-10,20H,1-3H3,(H,21,22,23)/b20-17- |
| InChIKey | QISBQDNTYJNGHX-JZJYNLBNSA-N |
| XLogP | 4.02 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|