C16H9N5OS — CID 123740941
4-[(2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-yl)amino]phenol (PubChem CID 123740941) has the molecular formula C16H9N5OS and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-[(2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-yl)amino]phenol.
| Compound Name | 4-[(2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-yl)amino]phenol |
|---|---|
| PubChem CID | 123740941 |
| Molecular Formula | C16H9N5OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-[(2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-yl)amino]phenol |
| SMILES | [C-]#[N+]c1nc2ccc3ncnc(Nc4ccc(O)cc4)c3c2s1 |
| InChI | InChI=1S/C16H9N5OS/c1-17-16-21-12-7-6-11-13(14(12)23-16)15(19-8-18-11)20-9-2-4-10(22)5-3-9/h2-8,22H,(H,18,19,20) |
| InChIKey | MZWQSQDXAQDZQH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|