C16H7Cl2N5S — CID 123841135
N-(3,4-dichlorophenyl)-2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-amine (PubChem CID 123841135) has the molecular formula C16H7Cl2N5S and a molecular weight of 372.24 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-amine.
| Compound Name | N-(3,4-dichlorophenyl)-2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-amine |
|---|---|
| PubChem CID | 123841135 |
| Molecular Formula | C16H7Cl2N5S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-isocyano-[1,3]thiazolo[5,4-f]quinazolin-9-amine |
| SMILES | [C-]#[N+]c1nc2ccc3ncnc(Nc4ccc(Cl)c(Cl)c4)c3c2s1 |
| InChI | InChI=1S/C16H7Cl2N5S/c1-19-16-23-12-5-4-11-13(14(12)24-16)15(21-7-20-11)22-8-2-3-9(17)10(18)6-8/h2-7H,(H,20,21,22) |
| InChIKey | WWTKWPJUUYTEEK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|