C19H15N5O3S — CID 71529626
ethyl 9-(1,3-benzodioxol-5-ylamino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 71529626) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is ethyl 9-(1,3-benzodioxol-5-ylamino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | ethyl 9-(1,3-benzodioxol-5-ylamino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 71529626 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | ethyl 9-(1,3-benzodioxol-5-ylamino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OCC)c1nc2ccc3ncnc(Nc4ccc5c(c4)OCO5)c3c2s1 |
| InChI | InChI=1S/C19H15N5O3S/c1-2-25-17(20)19-24-12-5-4-11-15(16(12)28-19)18(22-8-21-11)23-10-3-6-13-14(7-10)27-9-26-13/h3-8,20H,2,9H2,1H3,(H,21,22,23)/b20-17- |
| InChIKey | QCJWUXFCDRVWGH-JZJYNLBNSA-N |
| XLogP | 4.07 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|