C18H14N4O2 — CID 135818945
N-(1,3-benzodioxol-5-yl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine (PubChem CID 135818945) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine |
|---|---|
| PubChem CID | 135818945 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-7-methyl-6H-imidazo[4,5-f]quinolin-9-amine |
| SMILES | Cc1cc(Nc2ccc3c(c2)OCO3)c2c(ccc3ncnc32)[nH]1 |
| InChI | InChI=1S/C18H14N4O2/c1-10-6-14(22-11-2-5-15-16(7-11)24-9-23-15)17-12(21-10)3-4-13-18(17)20-8-19-13/h2-8,21-22H,9H2,1H3 |
| InChIKey | GGVIRHKLWVMKMA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |