C38H31Cl2FN10O2S2 — CID 164948862
ethyl 9-(2-chloro-4-fluoro-5-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate;ethyl 9-(2-chloro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 164948862) has the molecular formula C38H31Cl2FN10O2S2 and a molecular weight of 813.77 g/mol. Its IUPAC name is ethyl 9-(2-chloro-4-fluoro-5-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate;ethyl 9-(2-chloro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | ethyl 9-(2-chloro-4-fluoro-5-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate;ethyl 9-(2-chloro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 164948862 |
| Molecular Formula | C38H31Cl2FN10O2S2 |
| Molecular Weight | 813.77 g/mol |
| Exact Mass | 812.14 |
| IUPAC Name | ethyl 9-(2-chloro-4-fluoro-5-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate;ethyl 9-(2-chloro-4-methylanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OCC)c1nc2ccc3ncnc(Nc4cc(C)c(F)cc4Cl)c3c2s1.[H]/N=C(\OCC)c1nc2ccc3ncnc(Nc4ccc(C)cc4Cl)c3c2s1 |
| InChI | InChI=1S/C19H15ClFN5OS.C19H16ClN5OS/c1-3-27-17(22)19-26-13-5-4-12-15(16(13)28-19)18(24-8-23-12)25-14-6-9(2)11(21)7-10(14)20;1-3-26-17(21)19-25-14-7-6-13-15(16(14)27-19)18(23-9-22-13)24-12-5-4-10(2)8-11(12)20/h4-8,22H,3H2,1-2H3,(H,23,24,25);4-9,21H,3H2,1-2H3,(H,22,23,24)/b22-17-;21-17- |
| InChIKey | AGEGULNOUYSQRB-XCYPYGCTSA-N |
| XLogP | 10.75 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.77 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|