C20H16ClF2N5O3S2 — CID 167814081
3-methylsulfonylpropyl 9-(2-chloro-4,5-difluoroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 167814081) has the molecular formula C20H16ClF2N5O3S2 and a molecular weight of 511.96 g/mol. Its IUPAC name is 3-methylsulfonylpropyl 9-(2-chloro-4,5-difluoroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | 3-methylsulfonylpropyl 9-(2-chloro-4,5-difluoroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 167814081 |
| Molecular Formula | C20H16ClF2N5O3S2 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | 3-methylsulfonylpropyl 9-(2-chloro-4,5-difluoroanilino)-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OCCCS(C)(=O)=O)c1nc2ccc3ncnc(Nc4cc(F)c(F)cc4Cl)c3c2s1 |
| InChI | InChI=1S/C20H16ClF2N5O3S2/c1-33(29,30)6-2-5-31-18(24)20-28-14-4-3-13-16(17(14)32-20)19(26-9-25-13)27-15-8-12(23)11(22)7-10(15)21/h3-4,7-9,24H,2,5-6H2,1H3,(H,25,26,27)/b24-18- |
| InChIKey | BRLKJWWGRZZEMN-MOHJPFBDSA-N |
| XLogP | 4.69 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|