C17H13N5OS — CID 71529598
methyl 9-anilino-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 71529598) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl 9-anilino-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
| Compound Name | methyl 9-anilino-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
|---|---|
| PubChem CID | 71529598 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | methyl 9-anilino-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1nc2ccc3ncnc(Nc4ccccc4)c3c2s1 |
| InChI | InChI=1S/C17H13N5OS/c1-23-15(18)17-22-12-8-7-11-13(14(12)24-17)16(20-9-19-11)21-10-5-3-2-4-6-10/h2-9,18H,1H3,(H,19,20,21)/b18-15- |
| InChIKey | BIMZUQRAGIDOLB-SDXDJHTJSA-N |
| XLogP | 3.95 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|