C23H37N3O4 — CID 123645296
[1-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(4-octylbenzoyl)amino]propylidene]carbamic acid (PubChem CID 123645296) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is [1-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(4-octylbenzoyl)amino]propylidene]carbamic acid.
| Compound Name | [1-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(4-octylbenzoyl)amino]propylidene]carbamic acid |
|---|---|
| PubChem CID | 123645296 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | [1-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(4-octylbenzoyl)amino]propylidene]carbamic acid |
| SMILES | CCCCCCCCc1ccc(C(=O)NC(COC(C)(C)C)C(N)=NC(=O)O)cc1 |
| InChI | InChI=1S/C23H37N3O4/c1-5-6-7-8-9-10-11-17-12-14-18(15-13-17)21(27)25-19(16-30-23(2,3)4)20(24)26-22(28)29/h12-15,19H,5-11,16H2,1-4H3,(H2,24,26)(H,25,27)(H,28,29) |
| InChIKey | AHYXHGVASUCMAB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|