C11H16F2O2 — CID 123646835
6,6-difluoro-3,4,5-trimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 123646835) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is 6,6-difluoro-3,4,5-trimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | 6,6-difluoro-3,4,5-trimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 123646835 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6,6-difluoro-3,4,5-trimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | CC1OC(=O)C2CC(F)(F)C(C)C(C)C12 |
| InChI | InChI=1S/C11H16F2O2/c1-5-6(2)11(12,13)4-8-9(5)7(3)15-10(8)14/h5-9H,4H2,1-3H3 |
| InChIKey | CWABXWJJZNRERV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |