C13H22O3 — CID 143025691
5-ethyl-6-(hydroxymethyl)-3,4-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 143025691) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-ethyl-6-(hydroxymethyl)-3,4-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | 5-ethyl-6-(hydroxymethyl)-3,4-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 143025691 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 5-ethyl-6-(hydroxymethyl)-3,4-dimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CCC1C(CO)CC2C(=O)OC(C)C2C1C |
| InChI | InChI=1S/C13H22O3/c1-4-10-7(2)12-8(3)16-13(15)11(12)5-9(10)6-14/h7-12,14H,4-6H2,1-3H3 |
| InChIKey | DYYQJOHKQKWPBL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |