C11H16F2O3 — CID 123748267
6,6-difluoro-4-(hydroxymethyl)-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 123748267) has the molecular formula C11H16F2O3 and a molecular weight of 234.24 g/mol. Its IUPAC name is 6,6-difluoro-4-(hydroxymethyl)-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | 6,6-difluoro-4-(hydroxymethyl)-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 123748267 |
| Molecular Formula | C11H16F2O3 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 6,6-difluoro-4-(hydroxymethyl)-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | CC1OC(=O)C2CC(F)(F)C(C)C(CO)C12 |
| InChI | InChI=1S/C11H16F2O3/c1-5-8(4-14)9-6(2)16-10(15)7(9)3-11(5,12)13/h5-9,14H,3-4H2,1-2H3 |
| InChIKey | TZMOGNQILVEQGA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |