C21H38O4 — CID 123647846
2-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene;2-propoxyethyl 2-methylpropanoate (PubChem CID 123647846) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene;2-propoxyethyl 2-methylpropanoate.
| Compound Name | 2-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene;2-propoxyethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 123647846 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-(2-methoxyethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene;2-propoxyethyl 2-methylpropanoate |
| SMILES | CCCOCCOC(=O)C(C)C.COCCC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C12H20O.C9H18O3/c1-12(2)10-5-4-9(6-7-13-3)11(12)8-10;1-4-5-11-6-7-12-9(10)8(2)3/h4,10-11H,5-8H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | VSFARTMXNKSKNH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|