C19H40 — CID 123650268
3-ethyl-3,5,5,6,7-pentamethyldodecane (PubChem CID 123650268) has the molecular formula C19H40 and a molecular weight of 268.53 g/mol. Its IUPAC name is 3-ethyl-3,5,5,6,7-pentamethyldodecane.
| Compound Name | 3-ethyl-3,5,5,6,7-pentamethyldodecane |
|---|---|
| PubChem CID | 123650268 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 3-ethyl-3,5,5,6,7-pentamethyldodecane |
| SMILES | CCCCCC(C)C(C)C(C)(C)CC(C)(CC)CC |
| InChI | InChI=1S/C19H40/c1-9-12-13-14-16(4)17(5)18(6,7)15-19(8,10-2)11-3/h16-17H,9-15H2,1-8H3 |
| InChIKey | KCUCOXGHHZWJRE-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|