C20H28Br2N2OS — CID 123654689
N-[1-(3,5-dibromo-2-pyridinyl)-5-methyl-3-(2-methylprop-2-enyl)hex-4-enylidene]-2-methylpropane-2-sulfinamide (PubChem CID 123654689) has the molecular formula C20H28Br2N2OS and a molecular weight of 504.33 g/mol. Its IUPAC name is N-[1-(3,5-dibromo-2-pyridinyl)-5-methyl-3-(2-methylprop-2-enyl)hex-4-enylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(3,5-dibromo-2-pyridinyl)-5-methyl-3-(2-methylprop-2-enyl)hex-4-enylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123654689 |
| Molecular Formula | C20H28Br2N2OS |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | N-[1-(3,5-dibromo-2-pyridinyl)-5-methyl-3-(2-methylprop-2-enyl)hex-4-enylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C=C(C)CC(C=C(C)C)CC(=NS(=O)C(C)(C)C)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C20H28Br2N2OS/c1-13(2)8-15(9-14(3)4)10-18(24-26(25)20(5,6)7)19-17(22)11-16(21)12-23-19/h9,11-12,15H,1,8,10H2,2-7H3 |
| InChIKey | BUNFGNCLBDLKNX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|