C6H11N3O — CID 123659589
2,3,4,5-tetrahydropyridine-3-carbohydrazide (PubChem CID 123659589) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 2,3,4,5-tetrahydropyridine-3-carbohydrazide.
| Compound Name | 2,3,4,5-tetrahydropyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 123659589 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2,3,4,5-tetrahydropyridine-3-carbohydrazide |
| SMILES | NNC(=O)C1CCC=NC1 |
| InChI | InChI=1S/C6H11N3O/c7-9-6(10)5-2-1-3-8-4-5/h3,5H,1-2,4,7H2,(H,9,10) |
| InChIKey | IFLRBXPMHWUSAK-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|