C28H25BrFN2O5S- — CID 123666952
6-[2-(4-bromo-3-methoxyphenyl)ethyl-sulfinatoamino]-3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran (PubChem CID 123666952) has the molecular formula C28H25BrFN2O5S- and a molecular weight of 600.49 g/mol. Its IUPAC name is 6-[2-(4-bromo-3-methoxyphenyl)ethyl-sulfinatoamino]-3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran.
| Compound Name | 6-[2-(4-bromo-3-methoxyphenyl)ethyl-sulfinatoamino]-3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran |
|---|---|
| PubChem CID | 123666952 |
| Molecular Formula | C28H25BrFN2O5S- |
| Molecular Weight | 600.49 g/mol |
| Exact Mass | 599.07 |
| IUPAC Name | 6-[2-(4-bromo-3-methoxyphenyl)ethyl-sulfinatoamino]-3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran |
| SMILES | COc1cc(CCN(c2cc3oc(Cc4ccc(F)cc4)c(C(N)=O)c3cc2C2CC2)S(=O)[O-])ccc1Br |
| InChI | InChI=1S/C28H26BrFN2O5S/c1-36-25-12-17(4-9-22(25)29)10-11-32(38(34)35)23-15-24-21(14-20(23)18-5-6-18)27(28(31)33)26(37-24)13-16-2-7-19(30)8-3-16/h2-4,7-9,12,14-15,18H,5-6,10-11,13H2,1H3,(H2,31,33)(H,34,35)/p-1 |
| InChIKey | KQNSHVACDOMTJP-UHFFFAOYSA-M |
| XLogP | 5.75 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|