C35H37BF4N2O6S — CID 123428164
2-[4-[3-[[3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran-6-yl]-sulfinoamino]propyl]-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123428164) has the molecular formula C35H37BF4N2O6S and a molecular weight of 700.56 g/mol. Its IUPAC name is 2-[4-[3-[[3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran-6-yl]-sulfinoamino]propyl]-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[3-[[3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran-6-yl]-sulfinoamino]propyl]-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123428164 |
| Molecular Formula | C35H37BF4N2O6S |
| Molecular Weight | 700.56 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | 2-[4-[3-[[3-carbamoyl-5-cyclopropyl-2-[(4-fluorophenyl)methyl]-1-benzofuran-6-yl]-sulfinoamino]propyl]-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(CCCN(c3cc4oc(Cc5ccc(F)cc5)c(C(N)=O)c4cc3C3CC3)S(=O)O)cc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C35H37BF4N2O6S/c1-33(2)34(3,4)48-36(47-33)27-14-9-20(16-26(27)35(38,39)40)6-5-15-42(49(44)45)28-19-29-25(18-24(28)22-10-11-22)31(32(41)43)30(46-29)17-21-7-12-23(37)13-8-21/h7-9,12-14,16,18-19,22H,5-6,10-11,15,17H2,1-4H3,(H2,41,43)(H,44,45) |
| InChIKey | CFLHYZCPQAPFQU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|