C22H24N8 — CID 123668447
1-[4-(4-aminophenyl)-5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)pyrimidin-2-yl]piperidin-4-amine (PubChem CID 123668447) has the molecular formula C22H24N8 and a molecular weight of 400.49 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)-5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)pyrimidin-2-yl]piperidin-4-amine.
| Compound Name | 1-[4-(4-aminophenyl)-5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)pyrimidin-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 123668447 |
| Molecular Formula | C22H24N8 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[4-(4-aminophenyl)-5-(1-methylpyrazolo[4,5-b]pyridin-5-yl)pyrimidin-2-yl]piperidin-4-amine |
| SMILES | Cn1ncc2nc(-c3cnc(N4CCC(N)CC4)nc3-c3ccc(N)cc3)ccc21 |
| InChI | InChI=1S/C22H24N8/c1-29-20-7-6-18(27-19(20)13-26-29)17-12-25-22(30-10-8-16(24)9-11-30)28-21(17)14-2-4-15(23)5-3-14/h2-7,12-13,16H,8-11,23-24H2,1H3 |
| InChIKey | PULCDIPYVWHMQI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|