C23H14F3N3O4S — CID 123678096
6-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenoxy]phenyl]pyridine-2-carboxamide (PubChem CID 123678096) has the molecular formula C23H14F3N3O4S and a molecular weight of 485.44 g/mol. Its IUPAC name is 6-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenoxy]phenyl]pyridine-2-carboxamide.
| Compound Name | 6-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenoxy]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123678096 |
| Molecular Formula | C23H14F3N3O4S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 6-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenoxy]phenyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cccc(-c2ccc(Oc3ccc(C(F)(F)F)cc3C=C3SC(=O)NC3=O)cc2)n1 |
| InChI | InChI=1S/C23H14F3N3O4S/c24-23(25,26)14-6-9-18(13(10-14)11-19-21(31)29-22(32)34-19)33-15-7-4-12(5-8-15)16-2-1-3-17(28-16)20(27)30/h1-11H,(H2,27,30)(H,29,31,32) |
| InChIKey | FJEPIXVOCOPAPV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|