C14H22N2O8 — CID 123681464
3-[1,4-bis(carboxymethyl)-1,4-diazepan-6-yl]pentanedioic acid (PubChem CID 123681464) has the molecular formula C14H22N2O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-[1,4-bis(carboxymethyl)-1,4-diazepan-6-yl]pentanedioic acid.
| Compound Name | 3-[1,4-bis(carboxymethyl)-1,4-diazepan-6-yl]pentanedioic acid |
|---|---|
| PubChem CID | 123681464 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[1,4-bis(carboxymethyl)-1,4-diazepan-6-yl]pentanedioic acid |
| SMILES | O=C(O)CC(CC(=O)O)C1CN(CC(=O)O)CCN(CC(=O)O)C1 |
| InChI | InChI=1S/C14H22N2O8/c17-11(18)3-9(4-12(19)20)10-5-15(7-13(21)22)1-2-16(6-10)8-14(23)24/h9-10H,1-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | BHTPPRILSULGOU-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |