C11H3BrF12O — CID 123684675
1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethoxy)benzene (PubChem CID 123684675) has the molecular formula C11H3BrF12O and a molecular weight of 459.02 g/mol. Its IUPAC name is 1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethoxy)benzene.
| Compound Name | 1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 123684675 |
| Molecular Formula | C11H3BrF12O |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | 1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(trifluoromethoxy)benzene |
| SMILES | FC(F)(F)Oc1cc(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H3BrF12O/c12-5-1-4(2-6(3-5)25-11(22,23)24)7(13,9(16,17)18)8(14,15)10(19,20)21/h1-3H |
| InChIKey | LNXQZBVHMJKXCG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|