C9H12N4O5 — CID 123692801
(1R,10S,12S)-6-hydrazinyl-12-hydroxy-8,13-dioxa-2,4-diazatricyclo[8.2.1.02,7]tridec-6-ene-3,5-dione (PubChem CID 123692801) has the molecular formula C9H12N4O5 and a molecular weight of 256.22 g/mol. Its IUPAC name is (1R,10S,12S)-6-hydrazinyl-12-hydroxy-8,13-dioxa-2,4-diazatricyclo[8.2.1.02,7]tridec-6-ene-3,5-dione.
| Compound Name | (1R,10S,12S)-6-hydrazinyl-12-hydroxy-8,13-dioxa-2,4-diazatricyclo[8.2.1.02,7]tridec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 123692801 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (1R,10S,12S)-6-hydrazinyl-12-hydroxy-8,13-dioxa-2,4-diazatricyclo[8.2.1.02,7]tridec-6-ene-3,5-dione |
| SMILES | NNc1c2n(c(=O)[nH]c1=O)[C@@H]1O[C@H](CO2)C[C@@H]1O |
| InChI | InChI=1S/C9H12N4O5/c10-12-5-6(15)11-9(16)13-7-4(14)1-3(18-7)2-17-8(5)13/h3-4,7,12,14H,1-2,10H2,(H,11,15,16)/t3-,4-,7+/m0/s1 |
| InChIKey | AUOZJQPSVWIMGI-VJJSXZLQSA-N |
| XLogP | -2.14 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|