About 2-butyl-3-ethynyl-1,4-dimethylpiperazine
2-butyl-3-ethynyl-1,4-dimethylpiperazine (PubChem CID 123694542) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-butyl-3-ethynyl-1,4-dimethylpiperazine.
Molecular Properties
| Compound Name | 2-butyl-3-ethynyl-1,4-dimethylpiperazine |
| PubChem CID | 123694542 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-butyl-3-ethynyl-1,4-dimethylpiperazine |
| SMILES | C#CC1C(CCCC)N(C)CCN1C |
| InChI | InChI=1S/C12H22N2/c1-5-7-8-12-11(6-2)13(3)9-10-14(12)4/h2,11-12H,5,7-10H2,1,3-4H3 |
| InChIKey | RKYGZXMJVDLAFW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-3-ethynyl-1,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-ethynyl-1,4-dimethylpiperazine?
The IUPAC name of 2-butyl-3-ethynyl-1,4-dimethylpiperazine (CID 123694542) is 2-butyl-3-ethynyl-1,4-dimethylpiperazine.
What is the SMILES notation for 2-butyl-3-ethynyl-1,4-dimethylpiperazine?
The canonical SMILES for 2-butyl-3-ethynyl-1,4-dimethylpiperazine is C#CC1C(CCCC)N(C)CCN1C.
What is the InChIKey of 2-butyl-3-ethynyl-1,4-dimethylpiperazine?
The InChIKey is RKYGZXMJVDLAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-5-7-8-12-11(6-2)13(3)9-10-14(12)4/h2,11-12H,5,7-10H2,1,3-4H3.
What are the key properties of 2-butyl-3-ethynyl-1,4-dimethylpiperazine?
2-butyl-3-ethynyl-1,4-dimethylpiperazine has a molecular weight of 194.32 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-ethynyl-1,4-dimethylpiperazine is sourced from PubChem (CID 123694542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).