C32H44N3+ — CID 123698569
9,13-ditert-butyl-16,17-diethyl-17-methyl-4-propyl-8,12-diaza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2(7),3,5,9,11(19),12,14-octaene (PubChem CID 123698569) has the molecular formula C32H44N3+ and a molecular weight of 470.73 g/mol. Its IUPAC name is 9,13-ditert-butyl-16,17-diethyl-17-methyl-4-propyl-8,12-diaza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2(7),3,5,9,11(19),12,14-octaene.
| Compound Name | 9,13-ditert-butyl-16,17-diethyl-17-methyl-4-propyl-8,12-diaza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2(7),3,5,9,11(19),12,14-octaene |
|---|---|
| PubChem CID | 123698569 |
| Molecular Formula | C32H44N3+ |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.35 |
| IUPAC Name | 9,13-ditert-butyl-16,17-diethyl-17-methyl-4-propyl-8,12-diaza-1-azoniapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-1(18),2(7),3,5,9,11(19),12,14-octaene |
| SMILES | CCCc1ccc2c(c1)[n+]1c3c4c(cc(C(C)(C)C)nc4cc(C(C)(C)C)n23)C(CC)C1(C)CC |
| InChI | InChI=1S/C32H44N3/c1-11-14-20-15-16-24-25(17-20)35-29-28-21(22(12-2)32(35,10)13-3)18-26(30(4,5)6)33-23(28)19-27(34(24)29)31(7,8)9/h15-19,22H,11-14H2,1-10H3/q+1 |
| InChIKey | LOPJMOZOAXZSRX-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|