C7H6F3N5O — CID 123700803
8-methyl-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one (PubChem CID 123700803) has the molecular formula C7H6F3N5O and a molecular weight of 233.15 g/mol. Its IUPAC name is 8-methyl-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one.
| Compound Name | 8-methyl-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one |
|---|---|
| PubChem CID | 123700803 |
| Molecular Formula | C7H6F3N5O |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 8-methyl-3-(2,2,2-trifluoroethyl)imidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| SMILES | Cc1ncn2c(=O)n(CC(F)(F)F)nnc12 |
| InChI | InChI=1S/C7H6F3N5O/c1-4-5-12-13-15(2-7(8,9)10)6(16)14(5)3-11-4/h3H,2H2,1H3 |
| InChIKey | JIKQXPMMMXQIHS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |