C9H16N3O2+ — CID 123700995
[2-(2,5-dioxopyrrol-1-yl)ethylamino]-trimethylazanium (PubChem CID 123700995) has the molecular formula C9H16N3O2+ and a molecular weight of 198.25 g/mol. Its IUPAC name is [2-(2,5-dioxopyrrol-1-yl)ethylamino]-trimethylazanium.
| Compound Name | [2-(2,5-dioxopyrrol-1-yl)ethylamino]-trimethylazanium |
|---|---|
| PubChem CID | 123700995 |
| Molecular Formula | C9H16N3O2+ |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | [2-(2,5-dioxopyrrol-1-yl)ethylamino]-trimethylazanium |
| SMILES | C[N+](C)(C)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H16N3O2/c1-12(2,3)10-6-7-11-8(13)4-5-9(11)14/h4-5,10H,6-7H2,1-3H3/q+1 |
| InChIKey | JRACWDMHKAMSFC-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|