C21H27NO5 — CID 123702106
9'-methoxy-3',10'-dimethylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol (PubChem CID 123702106) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 9'-methoxy-3',10'-dimethylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol.
| Compound Name | 9'-methoxy-3',10'-dimethylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
|---|---|
| PubChem CID | 123702106 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 9'-methoxy-3',10'-dimethylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
| SMILES | COc1c(C)cc2c3c1OC1C4(CCC5(O)C(C2)N(C)CCC315)OCCO4 |
| InChI | InChI=1S/C21H27NO5/c1-12-10-13-11-14-20(23)4-5-21(25-8-9-26-21)18-19(20,6-7-22(14)2)15(13)17(27-18)16(12)24-3/h10,14,18,23H,4-9,11H2,1-3H3 |
| InChIKey | SSESIJIJSZXULY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |