C24H22N4O6 — CID 123703286
3-[[3-carbamoyl-7-(2-imino-4-oxopentan-3-yl)quinolin-4-yl]amino]-5-methoxycarbonylbenzoic acid (PubChem CID 123703286) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-[[3-carbamoyl-7-(2-imino-4-oxopentan-3-yl)quinolin-4-yl]amino]-5-methoxycarbonylbenzoic acid.
| Compound Name | 3-[[3-carbamoyl-7-(2-imino-4-oxopentan-3-yl)quinolin-4-yl]amino]-5-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 123703286 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-[[3-carbamoyl-7-(2-imino-4-oxopentan-3-yl)quinolin-4-yl]amino]-5-methoxycarbonylbenzoic acid |
| SMILES | [H]/N=C(\C)C(C(C)=O)c1ccc2c(Nc3cc(C(=O)O)cc(C(=O)OC)c3)c(C(N)=O)cnc2c1 |
| InChI | InChI=1S/C24H22N4O6/c1-11(25)20(12(2)29)13-4-5-17-19(9-13)27-10-18(22(26)30)21(17)28-16-7-14(23(31)32)6-15(8-16)24(33)34-3/h4-10,20,25H,1-3H3,(H2,26,30)(H,27,28)(H,31,32)/b25-11+ |
| InChIKey | VJKZEOCWFJUCSA-OPEKNORGSA-N |
| XLogP | 3.27 |
| TPSA | 172.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|