C24H49N2+ — CID 123703483
methyl-[7-[(2-methylcyclobutyl)amino]hept-1-enyl]-(6-methylheptan-3-yl)-propan-2-ylazanium (PubChem CID 123703483) has the molecular formula C24H49N2+ and a molecular weight of 365.67 g/mol. Its IUPAC name is methyl-[7-[(2-methylcyclobutyl)amino]hept-1-enyl]-(6-methylheptan-3-yl)-propan-2-ylazanium.
| Compound Name | methyl-[7-[(2-methylcyclobutyl)amino]hept-1-enyl]-(6-methylheptan-3-yl)-propan-2-ylazanium |
|---|---|
| PubChem CID | 123703483 |
| Molecular Formula | C24H49N2+ |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 365.39 |
| IUPAC Name | methyl-[7-[(2-methylcyclobutyl)amino]hept-1-enyl]-(6-methylheptan-3-yl)-propan-2-ylazanium |
| SMILES | CCC(CCC(C)C)[N+](C)(C=CCCCCCNC1CCC1C)C(C)C |
| InChI | InChI=1S/C24H49N2/c1-8-23(16-14-20(2)3)26(7,21(4)5)19-13-11-9-10-12-18-25-24-17-15-22(24)6/h13,19-25H,8-12,14-18H2,1-7H3/q+1 |
| InChIKey | BTWRRDDRFRNLKL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|