C20H39N — CID 153393913
but-1-ene;N-[1-(1,3-dimethylcyclobutyl)propyl]-3,4-dimethylpent-1-en-2-amine (PubChem CID 153393913) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is but-1-ene;N-[1-(1,3-dimethylcyclobutyl)propyl]-3,4-dimethylpent-1-en-2-amine.
| Compound Name | but-1-ene;N-[1-(1,3-dimethylcyclobutyl)propyl]-3,4-dimethylpent-1-en-2-amine |
|---|---|
| PubChem CID | 153393913 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | but-1-ene;N-[1-(1,3-dimethylcyclobutyl)propyl]-3,4-dimethylpent-1-en-2-amine |
| SMILES | C=C(NC(CC)C1(C)CC(C)C1)C(C)C(C)C.C=CCC |
| InChI | InChI=1S/C16H31N.C4H8/c1-8-15(16(7)9-12(4)10-16)17-14(6)13(5)11(2)3;1-3-4-2/h11-13,15,17H,6,8-10H2,1-5,7H3;3H,1,4H2,2H3 |
| InChIKey | XQDNNGRIZTXQMS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|