C21H20N2O2S — CID 123705159
N-[(4-cyclohexa-1,5-dien-1-ylphenyl)methyl]-1H-indole-2-sulfonamide (PubChem CID 123705159) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(4-cyclohexa-1,5-dien-1-ylphenyl)methyl]-1H-indole-2-sulfonamide.
| Compound Name | N-[(4-cyclohexa-1,5-dien-1-ylphenyl)methyl]-1H-indole-2-sulfonamide |
|---|---|
| PubChem CID | 123705159 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(4-cyclohexa-1,5-dien-1-ylphenyl)methyl]-1H-indole-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(C2=CCCC=C2)cc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H20N2O2S/c24-26(25,21-14-19-8-4-5-9-20(19)23-21)22-15-16-10-12-18(13-11-16)17-6-2-1-3-7-17/h2,4-14,22-23H,1,3,15H2 |
| InChIKey | TYWUZEOEHDDCSV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |