C15H16N4O — CID 123705389
4-[(3,5-diethyl-4-nitrosopyrazol-1-yl)methyl]benzonitrile (PubChem CID 123705389) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-[(3,5-diethyl-4-nitrosopyrazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(3,5-diethyl-4-nitrosopyrazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 123705389 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-[(3,5-diethyl-4-nitrosopyrazol-1-yl)methyl]benzonitrile |
| SMILES | CCc1nn(Cc2ccc(C#N)cc2)c(CC)c1N=O |
| InChI | InChI=1S/C15H16N4O/c1-3-13-15(18-20)14(4-2)19(17-13)10-12-7-5-11(9-16)6-8-12/h5-8H,3-4,10H2,1-2H3 |
| InChIKey | QVHRCMPXKCOPBC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |